C25H30N4O2S — CID 142861611
N-[4-[3-[(E)-3-methylbut-1-enyl]-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-5-yl]phenyl]formamide (PubChem CID 142861611) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is N-[4-[3-[(E)-3-methylbut-1-enyl]-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-5-yl]phenyl]formamide.
| Compound Name | N-[4-[3-[(E)-3-methylbut-1-enyl]-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-5-yl]phenyl]formamide |
|---|---|
| PubChem CID | 142861611 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[4-[3-[(E)-3-methylbut-1-enyl]-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-5-yl]phenyl]formamide |
| SMILES | CC(C)/C=C/N1CC(c2ccc(NC=O)cc2)S/C1=N\c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H30N4O2S/c1-19(2)11-12-29-17-24(20-3-5-21(6-4-20)26-18-30)32-25(29)27-22-7-9-23(10-8-22)28-13-15-31-16-14-28/h3-12,18-19,24H,13-17H2,1-2H3,(H,26,30)/b12-11+,27-25- |
| InChIKey | AZFDANFEVQFOBS-SPDYZOAQSA-N |
| XLogP | 5.04 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|