C31H34N6O3S — CID 142862033
(2S)-1-methyl-N-[4-[2-(4-morpholin-4-ylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 142862033) has the molecular formula C31H34N6O3S and a molecular weight of 570.72 g/mol. Its IUPAC name is (2S)-1-methyl-N-[4-[2-(4-morpholin-4-ylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-methyl-N-[4-[2-(4-morpholin-4-ylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142862033 |
| Molecular Formula | C31H34N6O3S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | (2S)-1-methyl-N-[4-[2-(4-morpholin-4-ylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | CN1CCC[C@H]1C(=O)Nc1ccc(C2S/C(=N\c3ccc(N4CCOCC4)cc3)N(Cc3ccccn3)C2=O)cc1 |
| InChI | InChI=1S/C31H34N6O3S/c1-35-16-4-6-27(35)29(38)33-23-9-7-22(8-10-23)28-30(39)37(21-25-5-2-3-15-32-25)31(41-28)34-24-11-13-26(14-12-24)36-17-19-40-20-18-36/h2-3,5,7-15,27-28H,4,6,16-21H2,1H3,(H,33,38)/b34-31-/t27-,28?/m0/s1 |
| InChIKey | DMZCKWBTPFBUQC-NMXCWECVSA-N |
| XLogP | 4.46 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|