C38H39N7O5S — CID 58806390
benzyl (2S)-2-[[4-[3-[(5-methylpyrazin-2-yl)methyl]-2-(4-morpholin-4-ylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 58806390) has the molecular formula C38H39N7O5S and a molecular weight of 705.84 g/mol. Its IUPAC name is benzyl (2S)-2-[[4-[3-[(5-methylpyrazin-2-yl)methyl]-2-(4-morpholin-4-ylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[4-[3-[(5-methylpyrazin-2-yl)methyl]-2-(4-morpholin-4-ylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58806390 |
| Molecular Formula | C38H39N7O5S |
| Molecular Weight | 705.84 g/mol |
| Exact Mass | 705.27 |
| IUPAC Name | benzyl (2S)-2-[[4-[3-[(5-methylpyrazin-2-yl)methyl]-2-(4-morpholin-4-ylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1cnc(CN2C(=O)C(c3ccc(NC(=O)[C@@H]4CCCN4C(=O)OCc4ccccc4)cc3)S/C2=N\c2ccc(N3CCOCC3)cc2)cn1 |
| InChI | InChI=1S/C38H39N7O5S/c1-26-22-40-31(23-39-26)24-45-36(47)34(51-37(45)42-30-13-15-32(16-14-30)43-18-20-49-21-19-43)28-9-11-29(12-10-28)41-35(46)33-8-5-17-44(33)38(48)50-25-27-6-3-2-4-7-27/h2-4,6-7,9-16,22-23,33-34H,5,8,17-21,24-25H2,1H3,(H,41,46)/b42-37-/t33-,34?/m0/s1 |
| InChIKey | VBYIVKVOIJFFHJ-DINPBXILSA-N |
| XLogP | 5.87 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.84 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|