C37H38N6O5S — CID 142861663
(2S)-1-[hydroxy(phenylmethoxy)methyl]-N-[4-[2-(4-morpholin-4-ylphenyl)imino-4-oxo-3-pyridin-2-yl-1,3-thiazolidin-5-yl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 142861663) has the molecular formula C37H38N6O5S and a molecular weight of 678.82 g/mol. Its IUPAC name is (2S)-1-[hydroxy(phenylmethoxy)methyl]-N-[4-[2-(4-morpholin-4-ylphenyl)imino-4-oxo-3-pyridin-2-yl-1,3-thiazolidin-5-yl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[hydroxy(phenylmethoxy)methyl]-N-[4-[2-(4-morpholin-4-ylphenyl)imino-4-oxo-3-pyridin-2-yl-1,3-thiazolidin-5-yl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142861663 |
| Molecular Formula | C37H38N6O5S |
| Molecular Weight | 678.82 g/mol |
| Exact Mass | 678.26 |
| IUPAC Name | (2S)-1-[hydroxy(phenylmethoxy)methyl]-N-[4-[2-(4-morpholin-4-ylphenyl)imino-4-oxo-3-pyridin-2-yl-1,3-thiazolidin-5-yl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C2S/C(=N\c3ccc(N4CCOCC4)cc3)N(c3ccccn3)C2=O)cc1)[C@@H]1CCCN1C(O)OCc1ccccc1 |
| InChI | InChI=1S/C37H38N6O5S/c44-34(31-9-6-20-42(31)37(46)48-25-26-7-2-1-3-8-26)39-28-13-11-27(12-14-28)33-35(45)43(32-10-4-5-19-38-32)36(49-33)40-29-15-17-30(18-16-29)41-21-23-47-24-22-41/h1-5,7-8,10-19,31,33,37,46H,6,9,20-25H2,(H,39,44)/b40-36-/t31-,33?,37?/m0/s1 |
| InChIKey | BNWYXUFVOYXDMN-YJTVDCSYSA-N |
| XLogP | 5.32 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.82 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|