C13H22NP — CID 142861995
N-[3-(3-methylphenyl)propyl]-2-phosphanylpropan-1-amine (PubChem CID 142861995) has the molecular formula C13H22NP and a molecular weight of 223.30 g/mol. Its IUPAC name is N-[3-(3-methylphenyl)propyl]-2-phosphanylpropan-1-amine.
| Compound Name | N-[3-(3-methylphenyl)propyl]-2-phosphanylpropan-1-amine |
|---|---|
| PubChem CID | 142861995 |
| Molecular Formula | C13H22NP |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | N-[3-(3-methylphenyl)propyl]-2-phosphanylpropan-1-amine |
| SMILES | Cc1cccc(CCCNCC(C)P)c1 |
| InChI | InChI=1S/C13H22NP/c1-11-5-3-6-13(9-11)7-4-8-14-10-12(2)15/h3,5-6,9,12,14H,4,7-8,10,15H2,1-2H3 |
| InChIKey | HOMFEVIFJOUNJI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|