C16H28N2 — CID 113405357
N'-tert-butyl-N-[3-(3-methylphenyl)propyl]ethane-1,2-diamine (PubChem CID 113405357) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N'-tert-butyl-N-[3-(3-methylphenyl)propyl]ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-[3-(3-methylphenyl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 113405357 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N'-tert-butyl-N-[3-(3-methylphenyl)propyl]ethane-1,2-diamine |
| SMILES | Cc1cccc(CCCNCCNC(C)(C)C)c1 |
| InChI | InChI=1S/C16H28N2/c1-14-7-5-8-15(13-14)9-6-10-17-11-12-18-16(2,3)4/h5,7-8,13,17-18H,6,9-12H2,1-4H3 |
| InChIKey | BKODJOQISCLUQK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|