C18H20F3N — CID 144539851
3-(3-methylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]propan-1-amine (PubChem CID 144539851) has the molecular formula C18H20F3N and a molecular weight of 307.36 g/mol. Its IUPAC name is 3-(3-methylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]propan-1-amine.
| Compound Name | 3-(3-methylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 144539851 |
| Molecular Formula | C18H20F3N |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-(3-methylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]propan-1-amine |
| SMILES | Cc1cccc(CCCNCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H20F3N/c1-14-4-2-5-15(12-14)6-3-11-22-13-16-7-9-17(10-8-16)18(19,20)21/h2,4-5,7-10,12,22H,3,6,11,13H2,1H3 |
| InChIKey | ZTONXANQILAGJG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|