C18H22BrNO4 — CID 142865861
5-bromo-2-[[(E)-pent-2-en-4-ynoyl]amino]benzoic acid;ethane;3-methoxyprop-1-ene (PubChem CID 142865861) has the molecular formula C18H22BrNO4 and a molecular weight of 396.28 g/mol. Its IUPAC name is 5-bromo-2-[[(E)-pent-2-en-4-ynoyl]amino]benzoic acid;ethane;3-methoxyprop-1-ene.
| Compound Name | 5-bromo-2-[[(E)-pent-2-en-4-ynoyl]amino]benzoic acid;ethane;3-methoxyprop-1-ene |
|---|---|
| PubChem CID | 142865861 |
| Molecular Formula | C18H22BrNO4 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 5-bromo-2-[[(E)-pent-2-en-4-ynoyl]amino]benzoic acid;ethane;3-methoxyprop-1-ene |
| SMILES | C#C/C=C/C(=O)Nc1ccc(Br)cc1C(=O)O.C=CCOC.CC |
| InChI | InChI=1S/C12H8BrNO3.C4H8O.C2H6/c1-2-3-4-11(15)14-10-6-5-8(13)7-9(10)12(16)17;1-3-4-5-2;1-2/h1,3-7H,(H,14,15)(H,16,17);3H,1,4H2,2H3;1-2H3/b4-3+;; |
| InChIKey | XBCVGVUNNYXSTL-CZEFNJPISA-N |
| XLogP | 4.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|