C21H18N2O3 — CID 142865663
5-cyano-2-[[(2E,4Z,6Z,7Z)-6-ethylidene-5-methyldeca-2,4,7-trien-9-ynoyl]amino]benzoic acid (PubChem CID 142865663) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 5-cyano-2-[[(2E,4Z,6Z,7Z)-6-ethylidene-5-methyldeca-2,4,7-trien-9-ynoyl]amino]benzoic acid.
| Compound Name | 5-cyano-2-[[(2E,4Z,6Z,7Z)-6-ethylidene-5-methyldeca-2,4,7-trien-9-ynoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 142865663 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 5-cyano-2-[[(2E,4Z,6Z,7Z)-6-ethylidene-5-methyldeca-2,4,7-trien-9-ynoyl]amino]benzoic acid |
| SMILES | C#C/C=C\C(=C\C)\C(C)=C/C=C/C(=O)Nc1ccc(C#N)cc1C(=O)O |
| InChI | InChI=1S/C21H18N2O3/c1-4-6-9-17(5-2)15(3)8-7-10-20(24)23-19-12-11-16(14-22)13-18(19)21(25)26/h1,5-13H,2-3H3,(H,23,24)(H,25,26)/b9-6-,10-7+,15-8-,17-5- |
| InChIKey | HPHOWWFXEYVHSB-QMBUTCGVSA-N |
| XLogP | 3.83 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|