C17H14N2O5 — CID 142865583
5-cyano-2-[[(2E)-2-[(5-methyl-1,3-dioxol-4-yl)methylidene]but-3-enoyl]amino]benzoic acid (PubChem CID 142865583) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 5-cyano-2-[[(2E)-2-[(5-methyl-1,3-dioxol-4-yl)methylidene]but-3-enoyl]amino]benzoic acid.
| Compound Name | 5-cyano-2-[[(2E)-2-[(5-methyl-1,3-dioxol-4-yl)methylidene]but-3-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 142865583 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-cyano-2-[[(2E)-2-[(5-methyl-1,3-dioxol-4-yl)methylidene]but-3-enoyl]amino]benzoic acid |
| SMILES | C=C/C(=C\C1=C(C)OCO1)C(=O)Nc1ccc(C#N)cc1C(=O)O |
| InChI | InChI=1S/C17H14N2O5/c1-3-12(7-15-10(2)23-9-24-15)16(20)19-14-5-4-11(8-18)6-13(14)17(21)22/h3-7H,1,9H2,2H3,(H,19,20)(H,21,22)/b12-7+ |
| InChIKey | BTISRUAXQTZLOF-KPKJPENVSA-N |
| XLogP | 2.54 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|