C18H17N3O5S — CID 142865977
5-cyano-2-[[4-(propylsulfamoyl)benzoyl]amino]benzoic acid (PubChem CID 142865977) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 5-cyano-2-[[4-(propylsulfamoyl)benzoyl]amino]benzoic acid.
| Compound Name | 5-cyano-2-[[4-(propylsulfamoyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 142865977 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 5-cyano-2-[[4-(propylsulfamoyl)benzoyl]amino]benzoic acid |
| SMILES | CCCNS(=O)(=O)c1ccc(C(=O)Nc2ccc(C#N)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C18H17N3O5S/c1-2-9-20-27(25,26)14-6-4-13(5-7-14)17(22)21-16-8-3-12(11-19)10-15(16)18(23)24/h3-8,10,20H,2,9H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | YPQOOWMMKDNOSC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |