C21H23N3O5S — CID 142866203
2-[[3-[butan-2-yl(ethyl)sulfamoyl]benzoyl]amino]-5-cyanobenzoic acid (PubChem CID 142866203) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-[[3-[butan-2-yl(ethyl)sulfamoyl]benzoyl]amino]-5-cyanobenzoic acid.
| Compound Name | 2-[[3-[butan-2-yl(ethyl)sulfamoyl]benzoyl]amino]-5-cyanobenzoic acid |
|---|---|
| PubChem CID | 142866203 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-[[3-[butan-2-yl(ethyl)sulfamoyl]benzoyl]amino]-5-cyanobenzoic acid |
| SMILES | CCC(C)N(CC)S(=O)(=O)c1cccc(C(=O)Nc2ccc(C#N)cc2C(=O)O)c1 |
| InChI | InChI=1S/C21H23N3O5S/c1-4-14(3)24(5-2)30(28,29)17-8-6-7-16(12-17)20(25)23-19-10-9-15(13-22)11-18(19)21(26)27/h6-12,14H,4-5H2,1-3H3,(H,23,25)(H,26,27) |
| InChIKey | VVOQOSBTBGQGFI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |