C17H23NO6S — CID 142866364
(4S)-2-[2,4-dihydroxy-5-[3-(3-methoxypropoxy)propyl]phenyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 142866364) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is (4S)-2-[2,4-dihydroxy-5-[3-(3-methoxypropoxy)propyl]phenyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-[2,4-dihydroxy-5-[3-(3-methoxypropoxy)propyl]phenyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 142866364 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (4S)-2-[2,4-dihydroxy-5-[3-(3-methoxypropoxy)propyl]phenyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | COCCCOCCCc1cc(C2=N[C@@H](C(=O)O)CS2)c(O)cc1O |
| InChI | InChI=1S/C17H23NO6S/c1-23-5-3-7-24-6-2-4-11-8-12(15(20)9-14(11)19)16-18-13(10-25-16)17(21)22/h8-9,13,19-20H,2-7,10H2,1H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | FYCPFZJRJYEMCK-CYBMUJFWSA-N |
| XLogP | 2.03 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|