C16H21NO5S — CID 137103375
1-[(4S)-2-[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4,5-dihydro-1,3-thiazol-4-yl]ethanone (PubChem CID 137103375) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is 1-[(4S)-2-[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4,5-dihydro-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[(4S)-2-[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4,5-dihydro-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 137103375 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-[(4S)-2-[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4,5-dihydro-1,3-thiazol-4-yl]ethanone |
| SMILES | COCCOCCOc1ccc(C2=N[C@@H](C(C)=O)CS2)c(O)c1 |
| InChI | InChI=1S/C16H21NO5S/c1-11(18)14-10-23-16(17-14)13-4-3-12(9-15(13)19)22-8-7-21-6-5-20-2/h3-4,9,14,19H,5-8,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | RZUCWZIYGBALIP-CQSZACIVSA-N |
| XLogP | 1.88 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|