C15H23NO4S — CID 141435625
5-[2-(2-methoxyethoxy)ethoxy]-2-(4-methyl-1,2-thiazolidin-2-yl)phenol (PubChem CID 141435625) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 5-[2-(2-methoxyethoxy)ethoxy]-2-(4-methyl-1,2-thiazolidin-2-yl)phenol.
| Compound Name | 5-[2-(2-methoxyethoxy)ethoxy]-2-(4-methyl-1,2-thiazolidin-2-yl)phenol |
|---|---|
| PubChem CID | 141435625 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5-[2-(2-methoxyethoxy)ethoxy]-2-(4-methyl-1,2-thiazolidin-2-yl)phenol |
| SMILES | COCCOCCOc1ccc(N2CC(C)CS2)c(O)c1 |
| InChI | InChI=1S/C15H23NO4S/c1-12-10-16(21-11-12)14-4-3-13(9-15(14)17)20-8-7-19-6-5-18-2/h3-4,9,12,17H,5-8,10-11H2,1-2H3 |
| InChIKey | IPIVNJMUUQOSFF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|