C16H21NO4S — CID 137286571
methyl (4S)-2-(4-butoxy-2-hydroxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylate (PubChem CID 137286571) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is methyl (4S)-2-(4-butoxy-2-hydroxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylate.
| Compound Name | methyl (4S)-2-(4-butoxy-2-hydroxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 137286571 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | methyl (4S)-2-(4-butoxy-2-hydroxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylate |
| SMILES | CCCCOc1ccc(C2=N[C@@](C)(C(=O)OC)CS2)c(O)c1 |
| InChI | InChI=1S/C16H21NO4S/c1-4-5-8-21-11-6-7-12(13(18)9-11)14-17-16(2,10-22-14)15(19)20-3/h6-7,9,18H,4-5,8,10H2,1-3H3/t16-/m1/s1 |
| InChIKey | BLUTVCLGPUAKQQ-MRXNPFEDSA-N |
| XLogP | 3.00 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|