C26H39NO8S — CID 67480512
(4S)-2-[2-(2-ethylhexanoyloxy)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid (PubChem CID 67480512) has the molecular formula C26H39NO8S and a molecular weight of 525.66 g/mol. Its IUPAC name is (4S)-2-[2-(2-ethylhexanoyloxy)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-[2-(2-ethylhexanoyloxy)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67480512 |
| Molecular Formula | C26H39NO8S |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | (4S)-2-[2-(2-ethylhexanoyloxy)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCC(CC)C(=O)Oc1cc(OCCOCCOCCOC)ccc1C1=N[C@@](C)(C(=O)O)CS1 |
| InChI | InChI=1S/C26H39NO8S/c1-5-7-8-19(6-2)24(28)35-22-17-20(34-16-15-33-14-13-32-12-11-31-4)9-10-21(22)23-27-26(3,18-36-23)25(29)30/h9-10,17,19H,5-8,11-16,18H2,1-4H3,(H,29,30)/t19?,26-/m1/s1 |
| InChIKey | SGZYRKZBQOBDTJ-COTLDPOVSA-N |
| XLogP | 4.20 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|