C20H31NO7S-2 — CID 158441630
methane;(4S)-2-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-oxidophenyl]-4-methyl-5H-1,3-thiazole-4-carboxylate (PubChem CID 158441630) has the molecular formula C20H31NO7S-2 and a molecular weight of 429.54 g/mol. Its IUPAC name is methane;(4S)-2-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-oxidophenyl]-4-methyl-5H-1,3-thiazole-4-carboxylate.
| Compound Name | methane;(4S)-2-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-oxidophenyl]-4-methyl-5H-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 158441630 |
| Molecular Formula | C20H31NO7S-2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | methane;(4S)-2-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-oxidophenyl]-4-methyl-5H-1,3-thiazole-4-carboxylate |
| SMILES | C.C.COCCOCCOCCOc1cccc(C2=N[C@@](C)(C(=O)[O-])CS2)c1[O-] |
| InChI | InChI=1S/C18H25NO7S.2CH4/c1-18(17(21)22)12-27-16(19-18)13-4-3-5-14(15(13)20)26-11-10-25-9-8-24-7-6-23-2;;/h3-5,20H,6-12H2,1-2H3,(H,21,22);2*1H4/p-2/t18-;;/m1../s1 |
| InChIKey | HCWQZMWXCFHHCT-JPKZNVRTSA-L |
| XLogP | 1.09 |
| TPSA | 112.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|