C19H26NO6S- — CID 157179655
2-[(4S)-4-acetyl-4-methyl-5H-1,3-thiazol-2-yl]-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenolate (PubChem CID 157179655) has the molecular formula C19H26NO6S- and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[(4S)-4-acetyl-4-methyl-5H-1,3-thiazol-2-yl]-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenolate.
| Compound Name | 2-[(4S)-4-acetyl-4-methyl-5H-1,3-thiazol-2-yl]-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenolate |
|---|---|
| PubChem CID | 157179655 |
| Molecular Formula | C19H26NO6S- |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[(4S)-4-acetyl-4-methyl-5H-1,3-thiazol-2-yl]-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenolate |
| SMILES | COCCOCCOCCOc1cccc(C2=N[C@@](C)(C(C)=O)CS2)c1[O-] |
| InChI | InChI=1S/C19H27NO6S/c1-14(21)19(2)13-27-18(20-19)15-5-4-6-16(17(15)22)26-12-11-25-10-9-24-8-7-23-3/h4-6,22H,7-13H2,1-3H3/p-1/t19-/m1/s1 |
| InChIKey | AOKOIJXZKYYYES-LJQANCHMSA-M |
| XLogP | 1.66 |
| TPSA | 89.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|