C16H21NO5S — CID 148862404
(4S)-2-[4-[2-(2-hydroxyethoxy)ethoxy]-2-methylphenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid (PubChem CID 148862404) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is (4S)-2-[4-[2-(2-hydroxyethoxy)ethoxy]-2-methylphenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-[4-[2-(2-hydroxyethoxy)ethoxy]-2-methylphenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 148862404 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (4S)-2-[4-[2-(2-hydroxyethoxy)ethoxy]-2-methylphenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1cc(OCCOCCO)ccc1C1=N[C@@](C)(C(=O)O)CS1 |
| InChI | InChI=1S/C16H21NO5S/c1-11-9-12(22-8-7-21-6-5-18)3-4-13(11)14-17-16(2,10-23-14)15(19)20/h3-4,9,18H,5-8,10H2,1-2H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | OZOXGRFQEFKWQT-MRXNPFEDSA-N |
| XLogP | 1.72 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|