C23H33NO12S — CID 144849526
(4S)-2-[2-hydroxy-4-[2-[2-[2-[(2R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid (PubChem CID 144849526) has the molecular formula C23H33NO12S and a molecular weight of 547.58 g/mol. Its IUPAC name is (4S)-2-[2-hydroxy-4-[2-[2-[2-[(2R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-[2-hydroxy-4-[2-[2-[2-[(2R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 144849526 |
| Molecular Formula | C23H33NO12S |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | (4S)-2-[2-hydroxy-4-[2-[2-[2-[(2R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CSC(c2ccc(OCCOCCOCCO[C@@H]3OC(CO)[C@H](O)C(O)C3O)cc2O)=N1 |
| InChI | InChI=1S/C23H33NO12S/c1-23(22(30)31)12-37-20(24-23)14-3-2-13(10-15(14)26)34-8-6-32-4-5-33-7-9-35-21-19(29)18(28)17(27)16(11-25)36-21/h2-3,10,16-19,21,25-29H,4-9,11-12H2,1H3,(H,30,31)/t16?,17-,18?,19?,21+,23+/m0/s1 |
| InChIKey | IBTRHVKLWWBAOB-LDBRJSQTSA-N |
| XLogP | -1.04 |
| TPSA | 196.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|