C22H32N2O12S — CID 144849595
(4S)-2-[3-hydroxy-5-[2-[2-[2-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]-2-pyridinyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid (PubChem CID 144849595) has the molecular formula C22H32N2O12S and a molecular weight of 548.57 g/mol. Its IUPAC name is (4S)-2-[3-hydroxy-5-[2-[2-[2-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]-2-pyridinyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-[3-hydroxy-5-[2-[2-[2-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]-2-pyridinyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 144849595 |
| Molecular Formula | C22H32N2O12S |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | (4S)-2-[3-hydroxy-5-[2-[2-[2-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]-2-pyridinyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CSC(c2ncc(OCCOCCOCCO[C@H]3OC(CO)[C@H](O)C(O)C3O)cc2O)=N1 |
| InChI | InChI=1S/C22H32N2O12S/c1-22(21(30)31)11-37-19(24-22)15-13(26)8-12(9-23-15)34-6-4-32-2-3-33-5-7-35-20-18(29)17(28)16(27)14(10-25)36-20/h8-9,14,16-18,20,25-29H,2-7,10-11H2,1H3,(H,30,31)/t14?,16-,17?,18?,20-,22+/m0/s1 |
| InChIKey | MUPQJWIOCCYOMF-COEGZECKSA-N |
| XLogP | -1.65 |
| TPSA | 209.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|