C16H23N2O5S- — CID 158754110
(4S)-2-[3-hydroxy-4-(2-propoxyethoxy)-2-pyridinyl]-4-methyl-5H-1,3-thiazole-4-carboxylate;methane (PubChem CID 158754110) has the molecular formula C16H23N2O5S- and a molecular weight of 355.44 g/mol. Its IUPAC name is (4S)-2-[3-hydroxy-4-(2-propoxyethoxy)-2-pyridinyl]-4-methyl-5H-1,3-thiazole-4-carboxylate;methane.
| Compound Name | (4S)-2-[3-hydroxy-4-(2-propoxyethoxy)-2-pyridinyl]-4-methyl-5H-1,3-thiazole-4-carboxylate;methane |
|---|---|
| PubChem CID | 158754110 |
| Molecular Formula | C16H23N2O5S- |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (4S)-2-[3-hydroxy-4-(2-propoxyethoxy)-2-pyridinyl]-4-methyl-5H-1,3-thiazole-4-carboxylate;methane |
| SMILES | C.CCCOCCOc1ccnc(C2=N[C@@](C)(C(=O)[O-])CS2)c1O |
| InChI | InChI=1S/C15H20N2O5S.CH4/c1-3-6-21-7-8-22-10-4-5-16-11(12(10)18)13-17-15(2,9-23-13)14(19)20;/h4-5,18H,3,6-9H2,1-2H3,(H,19,20);1H4/p-1/t15-;/m1./s1 |
| InChIKey | INVQXIOLAPOTNE-XFULWGLBSA-M |
| XLogP | 1.23 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|