C15H20N3O5- — CID 159919284
2-[3-hydroxy-4-(2-propoxyethoxy)-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate (PubChem CID 159919284) has the molecular formula C15H20N3O5- and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-[3-hydroxy-4-(2-propoxyethoxy)-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate.
| Compound Name | 2-[3-hydroxy-4-(2-propoxyethoxy)-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate |
|---|---|
| PubChem CID | 159919284 |
| Molecular Formula | C15H20N3O5- |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[3-hydroxy-4-(2-propoxyethoxy)-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate |
| SMILES | CCCOCCOc1ccnc(C2=NCC(C)(C(=O)[O-])N2)c1O |
| InChI | InChI=1S/C15H21N3O5/c1-3-6-22-7-8-23-10-4-5-16-11(12(10)19)13-17-9-15(2,18-13)14(20)21/h4-5,19H,3,6-9H2,1-2H3,(H,17,18)(H,20,21)/p-1 |
| InChIKey | NYEODSVDPAZSHS-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|