C15H19N2O7- — CID 140744252
(4R)-2-[3-hydroxy-6-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-4-methyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 140744252) has the molecular formula C15H19N2O7- and a molecular weight of 339.32 g/mol. Its IUPAC name is (4R)-2-[3-hydroxy-6-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-4-methyl-5H-1,3-oxazole-4-carboxylate.
| Compound Name | (4R)-2-[3-hydroxy-6-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-4-methyl-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 140744252 |
| Molecular Formula | C15H19N2O7- |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (4R)-2-[3-hydroxy-6-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-4-methyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | COCCOCCOc1ccc(O)c(C2=N[C@@](C)(C(=O)[O-])CO2)n1 |
| InChI | InChI=1S/C15H20N2O7/c1-15(14(19)20)9-24-13(17-15)12-10(18)3-4-11(16-12)23-8-7-22-6-5-21-2/h3-4,18H,5-9H2,1-2H3,(H,19,20)/p-1/t15-/m1/s1 |
| InChIKey | RFIKZJMWSRWIIO-OAHLLOKOSA-M |
| XLogP | -0.89 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|