C15H20N3O6- — CID 147413945
2-[3-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate (PubChem CID 147413945) has the molecular formula C15H20N3O6- and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-[3-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate.
| Compound Name | 2-[3-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate |
|---|---|
| PubChem CID | 147413945 |
| Molecular Formula | C15H20N3O6- |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[3-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate |
| SMILES | COCCOCCOc1ccnc(C2=NCC(C)(C(=O)[O-])N2)c1O |
| InChI | InChI=1S/C15H21N3O6/c1-15(14(20)21)9-17-13(18-15)11-12(19)10(3-4-16-11)24-8-7-23-6-5-22-2/h3-4,19H,5-9H2,1-2H3,(H,17,18)(H,20,21)/p-1 |
| InChIKey | DRDQERTUODDGIO-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|