C16H24N3O6- — CID 158589909
2-[3-hydroxy-5-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate;methane (PubChem CID 158589909) has the molecular formula C16H24N3O6- and a molecular weight of 354.38 g/mol. Its IUPAC name is 2-[3-hydroxy-5-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate;methane.
| Compound Name | 2-[3-hydroxy-5-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate;methane |
|---|---|
| PubChem CID | 158589909 |
| Molecular Formula | C16H24N3O6- |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[3-hydroxy-5-[2-(2-methoxyethoxy)ethoxy]-2-pyridinyl]-5-methyl-1,4-dihydroimidazole-5-carboxylate;methane |
| SMILES | C.COCCOCCOc1cnc(C2=NCC(C)(C(=O)[O-])N2)c(O)c1 |
| InChI | InChI=1S/C15H21N3O6.CH4/c1-15(14(20)21)9-17-13(18-15)12-11(19)7-10(8-16-12)24-6-5-23-4-3-22-2;/h7-8,19H,3-6,9H2,1-2H3,(H,17,18)(H,20,21);1H4/p-1 |
| InChIKey | HUHVYEPWZYGJTR-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|