C27H42NNaO5S — CID 135960761
sodium (4S)-2-(2-hydroxy-4,5-dioctoxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylate (PubChem CID 135960761) has the molecular formula C27H42NNaO5S and a molecular weight of 515.69 g/mol. Its IUPAC name is sodium (4S)-2-(2-hydroxy-4,5-dioctoxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylate.
| Compound Name | sodium (4S)-2-(2-hydroxy-4,5-dioctoxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 135960761 |
| Molecular Formula | C27H42NNaO5S |
| Molecular Weight | 515.69 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | sodium (4S)-2-(2-hydroxy-4,5-dioctoxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCCCCOc1cc(O)c(C2=N[C@@](C)(C(=O)[O-])CS2)cc1OCCCCCCCC.[Na+] |
| InChI | InChI=1S/C27H43NO5S.Na/c1-4-6-8-10-12-14-16-32-23-18-21(25-28-27(3,20-34-25)26(30)31)22(29)19-24(23)33-17-15-13-11-9-7-5-2;/h18-19,29H,4-17,20H2,1-3H3,(H,30,31);/q;+1/p-1/t27-;/m1./s1 |
| InChIKey | STGOVXDBCJIEOO-HZPIKELBSA-M |
| XLogP | 2.88 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|