C54H81N9O15S3 — CID 162012470
1-[(4S)-2-[3-hydroxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-2-pyridinyl]-4-methyl-5H-1,3-thiazol-4-yl]ethanone (PubChem CID 162012470) has the molecular formula C54H81N9O15S3 and a molecular weight of 1192.49 g/mol. Its IUPAC name is 1-[(4S)-2-[3-hydroxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-2-pyridinyl]-4-methyl-5H-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[(4S)-2-[3-hydroxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-2-pyridinyl]-4-methyl-5H-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 162012470 |
| Molecular Formula | C54H81N9O15S3 |
| Molecular Weight | 1192.49 g/mol |
| Exact Mass | 1191.50 |
| IUPAC Name | 1-[(4S)-2-[3-hydroxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-2-pyridinyl]-4-methyl-5H-1,3-thiazol-4-yl]ethanone |
| SMILES | COCCOCCOCCNc1ccnc(C2=N[C@@](C)(C(C)=O)CS2)c1O.COCCOCCOCCNc1ccnc(C2=N[C@@](C)(C(C)=O)CS2)c1O.COCCOCCOCCNc1ccnc(C2=N[C@@](C)(C(C)=O)CS2)c1O |
| InChI | InChI=1S/3C18H27N3O5S/c3*1-13(22)18(2)12-27-17(21-18)15-16(23)14(4-5-20-15)19-6-7-25-10-11-26-9-8-24-3/h3*4-5,23H,6-12H2,1-3H3,(H,19,20)/t3*18-/m111/s1 |
| InChIKey | YTQSIETXWWSFGN-ASLRWESXSA-N |
| XLogP | 5.16 |
| TPSA | 306.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 27 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 81 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1192.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 27 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|