C20H28F2N3O3P — CID 142866393
6-[4-[difluoro(phosphanyl)methoxy]-2-methoxyphenyl]-3-hexan-3-yloxy-N,5-dimethylpyrazin-2-amine (PubChem CID 142866393) has the molecular formula C20H28F2N3O3P and a molecular weight of 427.43 g/mol. Its IUPAC name is 6-[4-[difluoro(phosphanyl)methoxy]-2-methoxyphenyl]-3-hexan-3-yloxy-N,5-dimethylpyrazin-2-amine.
| Compound Name | 6-[4-[difluoro(phosphanyl)methoxy]-2-methoxyphenyl]-3-hexan-3-yloxy-N,5-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 142866393 |
| Molecular Formula | C20H28F2N3O3P |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 6-[4-[difluoro(phosphanyl)methoxy]-2-methoxyphenyl]-3-hexan-3-yloxy-N,5-dimethylpyrazin-2-amine |
| SMILES | CCCC(CC)Oc1nc(C)c(-c2ccc(OC(F)(F)P)cc2OC)nc1NC |
| InChI | InChI=1S/C20H28F2N3O3P/c1-6-8-13(7-2)27-19-18(23-4)25-17(12(3)24-19)15-10-9-14(11-16(15)26-5)28-20(21,22)29/h9-11,13H,6-8,29H2,1-5H3,(H,23,25) |
| InChIKey | YCQHBFMQTMXNMO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|