C18H22F3N3O2 — CID 58804425
5-[2-methoxy-4-(trifluoromethoxy)phenyl]-6-methyl-N-pentan-3-ylpyrazin-2-amine (PubChem CID 58804425) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is 5-[2-methoxy-4-(trifluoromethoxy)phenyl]-6-methyl-N-pentan-3-ylpyrazin-2-amine.
| Compound Name | 5-[2-methoxy-4-(trifluoromethoxy)phenyl]-6-methyl-N-pentan-3-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 58804425 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 5-[2-methoxy-4-(trifluoromethoxy)phenyl]-6-methyl-N-pentan-3-ylpyrazin-2-amine |
| SMILES | CCC(CC)Nc1cnc(-c2ccc(OC(F)(F)F)cc2OC)c(C)n1 |
| InChI | InChI=1S/C18H22F3N3O2/c1-5-12(6-2)24-16-10-22-17(11(3)23-16)14-8-7-13(9-15(14)25-4)26-18(19,20)21/h7-10,12H,5-6H2,1-4H3,(H,23,24) |
| InChIKey | AANJUDGXVDCHCQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |