C12H19NO4S — CID 142868994
3-[1-(2,6-dioxopiperidin-1-yl)butylsulfanyl]propanoic acid (PubChem CID 142868994) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is 3-[1-(2,6-dioxopiperidin-1-yl)butylsulfanyl]propanoic acid.
| Compound Name | 3-[1-(2,6-dioxopiperidin-1-yl)butylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 142868994 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[1-(2,6-dioxopiperidin-1-yl)butylsulfanyl]propanoic acid |
| SMILES | CCCC(SCCC(=O)O)N1C(=O)CCCC1=O |
| InChI | InChI=1S/C12H19NO4S/c1-2-4-11(18-8-7-12(16)17)13-9(14)5-3-6-10(13)15/h11H,2-8H2,1H3,(H,16,17) |
| InChIKey | IBGYBKRRQNXJDF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|