3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid

C11H17NO4S — CID 142868996

IUPAC3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid
SMILESCCC(SCCC(=O)O)N1C(=O)CCCC1=O
InChIInChI=1S/C11H17NO4S/c1-2-10(17-7-6-11(15)16)12-8(13)4-3-5-9(12)14/h10H,2-7H2,1H3,(H,15,16)
InChIKeyOPQGOEOTZPRIDO-UHFFFAOYSA-N
MW259.33 g/mol
LogP1.47
Rot. Bonds6

About 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid

3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid (PubChem CID 142868996) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid.

Molecular Properties

Compound Name3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid
PubChem CID142868996
Molecular FormulaC11H17NO4S
Molecular Weight259.33 g/mol
Exact Mass259.09
IUPAC Name3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid
SMILESCCC(SCCC(=O)O)N1C(=O)CCCC1=O
InChIInChI=1S/C11H17NO4S/c1-2-10(17-7-6-11(15)16)12-8(13)4-3-5-9(12)14/h10H,2-7H2,1H3,(H,15,16)
InChIKeyOPQGOEOTZPRIDO-UHFFFAOYSA-N
XLogP1.47
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.33
LogP ≤ 51.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid?
The IUPAC name of 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid (CID 142868996) is 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid.
What is the SMILES notation for 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid?
The canonical SMILES for 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid is CCC(SCCC(=O)O)N1C(=O)CCCC1=O.
What is the InChIKey of 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid?
The InChIKey is OPQGOEOTZPRIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4S/c1-2-10(17-7-6-11(15)16)12-8(13)4-3-5-9(12)14/h10H,2-7H2,1H3,(H,15,16).
What are the key properties of 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid?
3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid has a molecular weight of 259.33 g/mol, XLogP of 1.47, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,6-dioxopiperidin-1-yl)propylsulfanyl]propanoic acid is sourced from PubChem (CID 142868996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).