C37H62O4 — CID 142869659
(6R,7E,14S,15E,17E,19E)-10-methoxy-1-(3-methoxycyclohexyl)-6,8,12,14,20-pentamethyltetracosa-7,15,17,19-tetraene-5,11-dione (PubChem CID 142869659) has the molecular formula C37H62O4 and a molecular weight of 570.90 g/mol. Its IUPAC name is (6R,7E,14S,15E,17E,19E)-10-methoxy-1-(3-methoxycyclohexyl)-6,8,12,14,20-pentamethyltetracosa-7,15,17,19-tetraene-5,11-dione.
| Compound Name | (6R,7E,14S,15E,17E,19E)-10-methoxy-1-(3-methoxycyclohexyl)-6,8,12,14,20-pentamethyltetracosa-7,15,17,19-tetraene-5,11-dione |
|---|---|
| PubChem CID | 142869659 |
| Molecular Formula | C37H62O4 |
| Molecular Weight | 570.90 g/mol |
| Exact Mass | 570.46 |
| IUPAC Name | (6R,7E,14S,15E,17E,19E)-10-methoxy-1-(3-methoxycyclohexyl)-6,8,12,14,20-pentamethyltetracosa-7,15,17,19-tetraene-5,11-dione |
| SMILES | CCCC/C(C)=C/C=C/C=C/[C@@H](C)CC(C)C(=O)C(C/C(C)=C/[C@@H](C)C(=O)CCCCC1CCCC(OC)C1)OC |
| InChI | InChI=1S/C37H62O4/c1-9-10-17-28(2)18-12-11-13-19-29(3)24-32(6)37(39)36(41-8)26-30(4)25-31(5)35(38)23-15-14-20-33-21-16-22-34(27-33)40-7/h11-13,18-19,25,29,31-34,36H,9-10,14-17,20-24,26-27H2,1-8H3/b12-11+,19-13+,28-18+,30-25+/t29-,31-,32?,33?,34?,36?/m1/s1 |
| InChIKey | BHOSSVGUCJRPFN-YTSPCFGKSA-N |
| XLogP | 9.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.90 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|