C34H56O4 — CID 170209426
(7E,14S,15E,17E,19E)-9-hydroxy-1-(3-methoxycyclohexyl)-2,8,12,14,20-pentamethyldocosa-7,15,17,19-tetraene-5,11-dione (PubChem CID 170209426) has the molecular formula C34H56O4 and a molecular weight of 528.82 g/mol. Its IUPAC name is (7E,14S,15E,17E,19E)-9-hydroxy-1-(3-methoxycyclohexyl)-2,8,12,14,20-pentamethyldocosa-7,15,17,19-tetraene-5,11-dione.
| Compound Name | (7E,14S,15E,17E,19E)-9-hydroxy-1-(3-methoxycyclohexyl)-2,8,12,14,20-pentamethyldocosa-7,15,17,19-tetraene-5,11-dione |
|---|---|
| PubChem CID | 170209426 |
| Molecular Formula | C34H56O4 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.42 |
| IUPAC Name | (7E,14S,15E,17E,19E)-9-hydroxy-1-(3-methoxycyclohexyl)-2,8,12,14,20-pentamethyldocosa-7,15,17,19-tetraene-5,11-dione |
| SMILES | CC/C(C)=C/C=C/C=C/[C@@H](C)CC(C)C(=O)CC(O)/C(C)=C/CC(=O)CCC(C)CC1CCCC(OC)C1 |
| InChI | InChI=1S/C34H56O4/c1-8-25(2)13-10-9-11-14-26(3)21-29(6)34(37)24-33(36)28(5)18-20-31(35)19-17-27(4)22-30-15-12-16-32(23-30)38-7/h9-11,13-14,18,26-27,29-30,32-33,36H,8,12,15-17,19-24H2,1-7H3/b10-9+,14-11+,25-13+,28-18+/t26-,27?,29?,30?,32?,33?/m1/s1 |
| InChIKey | BPFPBICVWBMDAK-XVLBMELLSA-N |
| XLogP | 8.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|