About (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one
(8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one (PubChem CID 146586626) has the molecular formula C18H30O2
and a molecular weight of 278.44 g/mol. Its IUPAC name is (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one.
Molecular Properties
| Compound Name | (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one |
| PubChem CID | 146586626 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one |
| SMILES | CC#CC(C)C(=O)CC[C@H](C)C[C@@H]1CCC[C@H](OC)C1 |
| InChI | InChI=1S/C18H30O2/c1-5-7-15(3)18(19)11-10-14(2)12-16-8-6-9-17(13-16)20-4/h14-17H,6,8-13H2,1-4H3/t14-,15?,16-,17-/m0/s1 |
| InChIKey | BOVZFDBLPMVARL-VCAIXKDPSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one?
The IUPAC name of (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one (CID 146586626) is (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one.
What is the SMILES notation for (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one?
The canonical SMILES for (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one is CC#CC(C)C(=O)CC[C@H](C)C[C@@H]1CCC[C@H](OC)C1.
What is the InChIKey of (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one?
The InChIKey is BOVZFDBLPMVARL-VCAIXKDPSA-N. The full InChI is InChI=1S/C18H30O2/c1-5-7-15(3)18(19)11-10-14(2)12-16-8-6-9-17(13-16)20-4/h14-17H,6,8-13H2,1-4H3/t14-,15?,16-,17-/m0/s1.
What are the key properties of (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one?
(8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one has a molecular weight of 278.44 g/mol, XLogP of 4.23, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-9-[(1S,3S)-3-methoxycyclohexyl]-4,8-dimethylnon-2-yn-5-one is sourced from PubChem (CID 146586626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).