C16H21P — CID 142870317
[(2E)-3-methylpenta-2,4-dien-2-yl]-[1-(2-methylphenyl)prop-2-enyl]phosphane (PubChem CID 142870317) has the molecular formula C16H21P and a molecular weight of 244.32 g/mol. Its IUPAC name is [(2E)-3-methylpenta-2,4-dien-2-yl]-[1-(2-methylphenyl)prop-2-enyl]phosphane.
| Compound Name | [(2E)-3-methylpenta-2,4-dien-2-yl]-[1-(2-methylphenyl)prop-2-enyl]phosphane |
|---|---|
| PubChem CID | 142870317 |
| Molecular Formula | C16H21P |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | [(2E)-3-methylpenta-2,4-dien-2-yl]-[1-(2-methylphenyl)prop-2-enyl]phosphane |
| SMILES | C=C/C(C)=C(\C)PC(C=C)c1ccccc1C |
| InChI | InChI=1S/C16H21P/c1-6-12(3)14(5)17-16(7-2)15-11-9-8-10-13(15)4/h6-11,16-17H,1-2H2,3-5H3/b14-12+ |
| InChIKey | POEVTJDTKDDAMC-WYMLVPIESA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|