C21H29N3 — CID 142870718
N-[(1Z)-1-(4,5-dimethylpyrazol-1-yl)-3-(2-methylphenyl)buta-1,3-dienyl]pentan-1-amine (PubChem CID 142870718) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is N-[(1Z)-1-(4,5-dimethylpyrazol-1-yl)-3-(2-methylphenyl)buta-1,3-dienyl]pentan-1-amine.
| Compound Name | N-[(1Z)-1-(4,5-dimethylpyrazol-1-yl)-3-(2-methylphenyl)buta-1,3-dienyl]pentan-1-amine |
|---|---|
| PubChem CID | 142870718 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | N-[(1Z)-1-(4,5-dimethylpyrazol-1-yl)-3-(2-methylphenyl)buta-1,3-dienyl]pentan-1-amine |
| SMILES | C=C(/C=C(/NCCCCC)n1ncc(C)c1C)c1ccccc1C |
| InChI | InChI=1S/C21H29N3/c1-6-7-10-13-22-21(24-19(5)18(4)15-23-24)14-17(3)20-12-9-8-11-16(20)2/h8-9,11-12,14-15,22H,3,6-7,10,13H2,1-2,4-5H3/b21-14- |
| InChIKey | DGCIUVAISODICG-STZFKDTASA-N |
| XLogP | 5.10 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|