C26H34N4O — CID 143441741
N-[4-[[(1Z)-1-(4,5-dimethylpyrazol-1-yl)-3-(2-methylphenyl)buta-1,3-dienyl]amino]butyl]cyclopentene-1-carboxamide (PubChem CID 143441741) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is N-[4-[[(1Z)-1-(4,5-dimethylpyrazol-1-yl)-3-(2-methylphenyl)buta-1,3-dienyl]amino]butyl]cyclopentene-1-carboxamide.
| Compound Name | N-[4-[[(1Z)-1-(4,5-dimethylpyrazol-1-yl)-3-(2-methylphenyl)buta-1,3-dienyl]amino]butyl]cyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 143441741 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | N-[4-[[(1Z)-1-(4,5-dimethylpyrazol-1-yl)-3-(2-methylphenyl)buta-1,3-dienyl]amino]butyl]cyclopentene-1-carboxamide |
| SMILES | C=C(/C=C(/NCCCCNC(=O)C1=CCCC1)n1ncc(C)c1C)c1ccccc1C |
| InChI | InChI=1S/C26H34N4O/c1-19-11-5-8-14-24(19)20(2)17-25(30-22(4)21(3)18-29-30)27-15-9-10-16-28-26(31)23-12-6-7-13-23/h5,8,11-12,14,17-18,27H,2,6-7,9-10,13,15-16H2,1,3-4H3,(H,28,31)/b25-17- |
| InChIKey | XUPZYNXSCZXIMI-UQQQWYQISA-N |
| XLogP | 4.92 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|