C19H25BrN6O3 — CID 142871596
[1-[[3-bromo-7-(methylamino)pyrazolo[1,5-a]pyrimidin-5-yl]amino]cyclopentyl]methanol;[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl] formate (PubChem CID 142871596) has the molecular formula C19H25BrN6O3 and a molecular weight of 465.35 g/mol. Its IUPAC name is [1-[[3-bromo-7-(methylamino)pyrazolo[1,5-a]pyrimidin-5-yl]amino]cyclopentyl]methanol;[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl] formate.
| Compound Name | [1-[[3-bromo-7-(methylamino)pyrazolo[1,5-a]pyrimidin-5-yl]amino]cyclopentyl]methanol;[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl] formate |
|---|---|
| PubChem CID | 142871596 |
| Molecular Formula | C19H25BrN6O3 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [1-[[3-bromo-7-(methylamino)pyrazolo[1,5-a]pyrimidin-5-yl]amino]cyclopentyl]methanol;[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl] formate |
| SMILES | C=C/C(=C\N=C)OC=O.CNc1cc(NC2(CO)CCCC2)nc2c(Br)cnn12 |
| InChI | InChI=1S/C13H18BrN5O.C6H7NO2/c1-15-11-6-10(17-12-9(14)7-16-19(11)12)18-13(8-20)4-2-3-5-13;1-3-6(4-7-2)9-5-8/h6-7,15,20H,2-5,8H2,1H3,(H,17,18);3-5H,1-2H2/b;6-4+ |
| InChIKey | NFYIJWRGMGOWMS-DVXCEAISSA-N |
| XLogP | 3.14 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|