C22H30BrN5 — CID 163922193
3-bromo-7-N-[(2E,4Z)-2-ethenylhepta-2,4-dienyl]-5-N-[(1R,2R)-2-methylcyclohexyl]pyrazolo[1,5-a]pyrimidine-5,7-diamine (PubChem CID 163922193) has the molecular formula C22H30BrN5 and a molecular weight of 444.42 g/mol. Its IUPAC name is 3-bromo-7-N-[(2E,4Z)-2-ethenylhepta-2,4-dienyl]-5-N-[(1R,2R)-2-methylcyclohexyl]pyrazolo[1,5-a]pyrimidine-5,7-diamine.
| Compound Name | 3-bromo-7-N-[(2E,4Z)-2-ethenylhepta-2,4-dienyl]-5-N-[(1R,2R)-2-methylcyclohexyl]pyrazolo[1,5-a]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 163922193 |
| Molecular Formula | C22H30BrN5 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 3-bromo-7-N-[(2E,4Z)-2-ethenylhepta-2,4-dienyl]-5-N-[(1R,2R)-2-methylcyclohexyl]pyrazolo[1,5-a]pyrimidine-5,7-diamine |
| SMILES | C=C/C(=C\C=C/CC)CNc1cc(N[C@@H]2CCCC[C@H]2C)nc2c(Br)cnn12 |
| InChI | InChI=1S/C22H30BrN5/c1-4-6-7-11-17(5-2)14-24-21-13-20(26-19-12-9-8-10-16(19)3)27-22-18(23)15-25-28(21)22/h5-7,11,13,15-16,19,24H,2,4,8-10,12,14H2,1,3H3,(H,26,27)/b7-6-,17-11+/t16-,19-/m1/s1 |
| InChIKey | RBIVYYPXACNZGZ-OJAXSPDQSA-N |
| XLogP | 5.97 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|