C17H16BrN5O2 — CID 163540950
N-[(1Z,3E)-5-[[3-bromo-5-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]-4-methylpenta-1,3-dienyl]methanimine oxide (PubChem CID 163540950) has the molecular formula C17H16BrN5O2 and a molecular weight of 402.25 g/mol. Its IUPAC name is N-[(1Z,3E)-5-[[3-bromo-5-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]-4-methylpenta-1,3-dienyl]methanimine oxide.
| Compound Name | N-[(1Z,3E)-5-[[3-bromo-5-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]-4-methylpenta-1,3-dienyl]methanimine oxide |
|---|---|
| PubChem CID | 163540950 |
| Molecular Formula | C17H16BrN5O2 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-[(1Z,3E)-5-[[3-bromo-5-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]-4-methylpenta-1,3-dienyl]methanimine oxide |
| SMILES | C=[N+]([O-])/C=C\C=C(/C)CNc1cc(-c2ccco2)nc2c(Br)cnn12 |
| InChI | InChI=1S/C17H16BrN5O2/c1-12(5-3-7-22(2)24)10-19-16-9-14(15-6-4-8-25-15)21-17-13(18)11-20-23(16)17/h3-9,11,19H,2,10H2,1H3/b7-3-,12-5+ |
| InChIKey | FBAVRWLXUIQSND-GJOIUKJWSA-N |
| XLogP | 3.83 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|