C21H19BBrClN5O — CID 70806434
CID 70806434 (PubChem CID 70806434) has the molecular formula C21H19BBrClN5O and a molecular weight of 483.59 g/mol.
| Compound Name | CID 70806434 |
|---|---|
| PubChem CID | 70806434 |
| Molecular Formula | C21H19BBrClN5O |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | — |
| SMILES | CO[B]NCc1cccc(CNc2cc(-c3ccccc3Cl)nc3c(Br)cnn23)c1 |
| InChI | InChI=1S/C21H19BBrClN5O/c1-30-22-26-12-15-6-4-5-14(9-15)11-25-20-10-19(16-7-2-3-8-18(16)24)28-21-17(23)13-27-29(20)21/h2-10,13,25-26H,11-12H2,1H3 |
| InChIKey | DVKPTPJUAHNRQK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|