C21H21BrClN5 — CID 142871130
N-[(4-aminophenyl)methyl]-3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-amine;ethane (PubChem CID 142871130) has the molecular formula C21H21BrClN5 and a molecular weight of 458.79 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-amine;ethane.
| Compound Name | N-[(4-aminophenyl)methyl]-3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-amine;ethane |
|---|---|
| PubChem CID | 142871130 |
| Molecular Formula | C21H21BrClN5 |
| Molecular Weight | 458.79 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-amine;ethane |
| SMILES | CC.Nc1ccc(CNc2cc(-c3ccccc3Cl)nc3c(Br)cnn23)cc1 |
| InChI | InChI=1S/C19H15BrClN5.C2H6/c20-15-11-24-26-18(23-10-12-5-7-13(22)8-6-12)9-17(25-19(15)26)14-3-1-2-4-16(14)21;1-2/h1-9,11,23H,10,22H2;1-2H3 |
| InChIKey | AJPMYEIEXPZZNS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.79 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|