C21H18ClN5 — CID 88986606
N-[(4-aminophenyl)methyl]-5-(2-chlorophenyl)-3-ethenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 88986606) has the molecular formula C21H18ClN5 and a molecular weight of 375.86 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-5-(2-chlorophenyl)-3-ethenylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[(4-aminophenyl)methyl]-5-(2-chlorophenyl)-3-ethenylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 88986606 |
| Molecular Formula | C21H18ClN5 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-5-(2-chlorophenyl)-3-ethenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=Cc1cnn2c(NCc3ccc(N)cc3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C21H18ClN5/c1-2-15-13-25-27-20(24-12-14-7-9-16(23)10-8-14)11-19(26-21(15)27)17-5-3-4-6-18(17)22/h2-11,13,24H,1,12,23H2 |
| InChIKey | FUXDADYDZKSXOO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|