C25H26ClN5O — CID 89056006
4-[[3-[[5-(2-chlorophenyl)-3-ethenylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl-methylamino]methyl]phenol (PubChem CID 89056006) has the molecular formula C25H26ClN5O and a molecular weight of 447.97 g/mol. Its IUPAC name is 4-[[3-[[5-(2-chlorophenyl)-3-ethenylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl-methylamino]methyl]phenol.
| Compound Name | 4-[[3-[[5-(2-chlorophenyl)-3-ethenylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl-methylamino]methyl]phenol |
|---|---|
| PubChem CID | 89056006 |
| Molecular Formula | C25H26ClN5O |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-[[3-[[5-(2-chlorophenyl)-3-ethenylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl-methylamino]methyl]phenol |
| SMILES | C=Cc1cnn2c(NCCCN(C)Cc3ccc(O)cc3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C25H26ClN5O/c1-3-19-16-28-31-24(15-23(29-25(19)31)21-7-4-5-8-22(21)26)27-13-6-14-30(2)17-18-9-11-20(32)12-10-18/h3-5,7-12,15-16,27,32H,1,6,13-14,17H2,2H3 |
| InChIKey | JVQVTKGVSJNPNF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|