About CID 89023491
CID 89023491 (PubChem CID 89023491) has the molecular formula C16H12BN5O
and a molecular weight of 301.12 g/mol.
Molecular Properties
| Compound Name | CID 89023491 |
| PubChem CID | 89023491 |
| Molecular Formula | C16H12BN5O |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccnc3)cc(-c3ccco3)nc12 |
| InChI | InChI=1S/C16H12BN5O/c17-12-10-20-22-15(19-9-11-3-1-5-18-8-11)7-13(21-16(12)22)14-4-2-6-23-14/h1-8,10,19H,9H2 |
| InChIKey | MBDUNLILEHPVDW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89023491 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89023491?
The IUPAC name of CID 89023491 (CID 89023491) is not available.
What is the SMILES notation for CID 89023491?
The canonical SMILES for CID 89023491 is [B]c1cnn2c(NCc3cccnc3)cc(-c3ccco3)nc12.
What is the InChIKey of CID 89023491?
The InChIKey is MBDUNLILEHPVDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BN5O/c17-12-10-20-22-15(19-9-11-3-1-5-18-8-11)7-13(21-16(12)22)14-4-2-6-23-14/h1-8,10,19H,9H2.
What are the key properties of CID 89023491?
CID 89023491 has a molecular weight of 301.12 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89023491 is sourced from PubChem (CID 89023491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).