About CID 88856915
CID 88856915 (PubChem CID 88856915) has the molecular formula C16H10BN5O3
and a molecular weight of 331.10 g/mol.
Molecular Properties
| Compound Name | CID 88856915 |
| PubChem CID | 88856915 |
| Molecular Formula | C16H10BN5O3 |
| Molecular Weight | 331.10 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NC(=O)Oc3cccnc3)cc(-c3ccco3)nc12 |
| InChI | InChI=1S/C16H10BN5O3/c17-11-9-19-22-14(21-16(23)25-10-3-1-5-18-8-10)7-12(20-15(11)22)13-4-2-6-24-13/h1-9H,(H,21,23) |
| InChIKey | IRPJZYMRFQXMIR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.10 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88856915 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88856915?
The IUPAC name of CID 88856915 (CID 88856915) is not available.
What is the SMILES notation for CID 88856915?
The canonical SMILES for CID 88856915 is [B]c1cnn2c(NC(=O)Oc3cccnc3)cc(-c3ccco3)nc12.
What is the InChIKey of CID 88856915?
The InChIKey is IRPJZYMRFQXMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BN5O3/c17-11-9-19-22-14(21-16(23)25-10-3-1-5-18-8-10)7-12(20-15(11)22)13-4-2-6-24-13/h1-9H,(H,21,23).
What are the key properties of CID 88856915?
CID 88856915 has a molecular weight of 331.10 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88856915 is sourced from PubChem (CID 88856915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).