C12H8Cl2N2O2 — CID 4143685
pyridin-3-yl N-(2,5-dichlorophenyl)carbamate (PubChem CID 4143685) has the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. Its IUPAC name is pyridin-3-yl N-(2,5-dichlorophenyl)carbamate.
| Compound Name | pyridin-3-yl N-(2,5-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 4143685 |
| Molecular Formula | C12H8Cl2N2O2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | pyridin-3-yl N-(2,5-dichlorophenyl)carbamate |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)Oc1cccnc1 |
| InChI | InChI=1S/C12H8Cl2N2O2/c13-8-3-4-10(14)11(6-8)16-12(17)18-9-2-1-5-15-7-9/h1-7H,(H,16,17) |
| InChIKey | NMLCGIMNGWRECL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |