C21H28BrN5O — CID 90047972
[(1S,2R)-2-[[3-bromo-7-[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]amino]pyrazolo[1,5-a]pyrimidin-5-yl]-methylamino]cyclopentyl]methanol (PubChem CID 90047972) has the molecular formula C21H28BrN5O and a molecular weight of 446.39 g/mol. Its IUPAC name is [(1S,2R)-2-[[3-bromo-7-[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]amino]pyrazolo[1,5-a]pyrimidin-5-yl]-methylamino]cyclopentyl]methanol.
| Compound Name | [(1S,2R)-2-[[3-bromo-7-[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]amino]pyrazolo[1,5-a]pyrimidin-5-yl]-methylamino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 90047972 |
| Molecular Formula | C21H28BrN5O |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [(1S,2R)-2-[[3-bromo-7-[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]amino]pyrazolo[1,5-a]pyrimidin-5-yl]-methylamino]cyclopentyl]methanol |
| SMILES | C=C/C(=C\C=C/C)CNc1cc(N(C)[C@@H]2CCC[C@@H]2CO)nc2c(Br)cnn12 |
| InChI | InChI=1S/C21H28BrN5O/c1-4-6-8-15(5-2)12-23-19-11-20(25-21-17(22)13-24-27(19)21)26(3)18-10-7-9-16(18)14-28/h4-6,8,11,13,16,18,23,28H,2,7,9-10,12,14H2,1,3H3/b6-4-,15-8+/t16-,18-/m1/s1 |
| InChIKey | SLLUHMJSQXKGGS-KMOBWVRYSA-N |
| XLogP | 4.19 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|